CAS 5023-12-1 is the registry number for 6-methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methoxy-4H-1,4-benzoxazin-3-one (CAS 5023-12-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6-methoxy-4H-1,4-benzoxazin-3-one. InChIKey: YWGRZAGXNFIQBO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 6-methoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | YWGRZAGXNFIQBO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OCC(=O)N2 |
Computed by PubChem (NCBI)