cas: 152626-75-0 — see every product listed under this CAS number, including other names
6-Methoxy-5-nitro-1H-indazole 95% (CAS 152626-75-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A674698-100mg |
| cas | 152626-75-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 192.38 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1176.94 Pln | |
| Ambeed | 10g | 2155.94 Pln | |
| Ambeed | 25g | 4241.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A674698 |
6-methoxy-5-nitro-1H-indazole (CAS 152626-75-0) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 6-methoxy-5-nitro-1H-indazole. InChIKey: QULAONDBWZZTOI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 6-methoxy-5-nitro-1H-indazole |
| InChIKey | QULAONDBWZZTOI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)