cas: 1211516-51-6 — see every product listed under this CAS number, including other names
6-Methoxy-5-nitronicotinic acid, 95% (CAS 1211516-51-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A986091-100mg |
| cas | 1211516-51-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2884.62 Pln | |
| BLDpharm | 100mg | 197.73 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 830.84 Pln | |
| BLDpharm | 5g | 3107.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-methoxy-5-nitropyridine-3-carboxylic acid (CAS 1211516-51-6) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 6-methoxy-5-nitropyridine-3-carboxylic acid. InChIKey: UGHLUFXYOCSNRJ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 6-methoxy-5-nitropyridine-3-carboxylic acid |
| InChIKey | UGHLUFXYOCSNRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)