CAS 945-20-0 is the registry number for 5-Amino-2-hydroxy-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-amino-2-hydroxy-3-nitrobenzoic acid (CAS 945-20-0) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 5-amino-2-hydroxy-3-nitrobenzoic acid. InChIKey: QKQMGEMTKMXWKQ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 5-amino-2-hydroxy-3-nitrobenzoic acid |
| InChIKey | QKQMGEMTKMXWKQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)[N+](=O)[O-])N |
Computed by PubChem (NCBI)