CAS 609-93-8 appears in our catalog under these names: 2,6-Dinitro-p-cresol, wetted with ca 20% of water, 95%, 2,6-Dinitro-4-methylphenol, 2,6–Dinitro–p–cresol, 2,6-Dinitro-p-cresol (wetted with ca. 20% Water) (unit weight on dry weight basis), >98.0%(T)(GC), 2,6-Dinitro-p-cresol, 98%, 98%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
4-methyl-2,6-dinitrophenol (CAS 609-93-8) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 4-methyl-2,6-dinitrophenol. InChIKey: HOYRZHJJAHRMLL-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 4-methyl-2,6-dinitrophenol |
| InChIKey | HOYRZHJJAHRMLL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)