CAS 152460-07-6 appears in our catalog under these names: 1-(2-Methyl-5-nitrophenyl)guanidine, 97%, Imatinib Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methyl-5-nitrophenyl) nitrate (CAS 152460-07-6) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: (2-methyl-5-nitrophenyl) nitrate. InChIKey: OHCKVINPYGFWGN-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | (2-methyl-5-nitrophenyl) nitrate |
| InChIKey | OHCKVINPYGFWGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])O[N+](=O)[O-] |
Computed by PubChem (NCBI)