CAS 5327-44-6 appears in our catalog under these names: 3,5-Dinitroanisole, 96%, 3,5-Dinitroanisole, 1-methoxy-3,5-dinitrobenzene. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 2g, 50g.
1-methoxy-3,5-dinitrobenzene (CAS 5327-44-6) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 1-methoxy-3,5-dinitrobenzene. InChIKey: OTMLGCBMOMNGCV-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 1-methoxy-3,5-dinitrobenzene |
| InChIKey | OTMLGCBMOMNGCV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)