CAS 147283-78-1 appears in our catalog under these names: 2-[3-Nitro-2-oxo-1(2h)-pyridinyl]acetic acid, 95%, 2-(3-Nitro-2-oxopyridin-1(2H)-yl)acetic acid, 98%, 2-(3-Nitro-2-oxo-1,2-dihydropyridin-1-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g.
2-(3-nitro-2-oxo-1-pyridinyl)acetic acid (CAS 147283-78-1) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 2-(3-nitro-2-oxo-1-pyridinyl)acetic acid. InChIKey: KHEKZKBMUAPJPS-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 2-(3-nitro-2-oxo-1-pyridinyl)acetic acid |
| InChIKey | KHEKZKBMUAPJPS-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)