CAS 68191-07-1 is the registry number for 4-Methyl-2,3-dinitrophenol, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
4-methyl-2,3-dinitrophenol (CAS 68191-07-1) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 198.13 g/mol. IUPAC name: 4-methyl-2,3-dinitrophenol. InChIKey: HIQCTHFRLRVNPP-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 198.13 g/mol |
| IUPAC name | 4-methyl-2,3-dinitrophenol |
| InChIKey | HIQCTHFRLRVNPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)