cas: 52351-75-4 — see every product listed under this CAS number, including other names
6-Methoxyindoline-2,3-dione 98% (CAS 52351-75-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210396-100mg |
| cas | 52351-75-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 559.50 Pln | |
| Ambeed | 100g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210396 |
6-methoxy-1H-indole-2,3-dione (CAS 52351-75-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 6-methoxy-1H-indole-2,3-dione. InChIKey: MOJHIZLOKWRPIS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-methoxy-1H-indole-2,3-dione |
| InChIKey | MOJHIZLOKWRPIS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)