CAS 1257649-53-8 is the registry number for 6-Methyl-2-vinyl-1,3,6,2-dioxazaborocane-4,8-dione, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1257649-53-8) is a chemical compound with the molecular formula C7H10BNO4 and a molecular weight of 182.97 g/mol. IUPAC name: 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: MGRQGYAVASCCAK-UHFFFAOYSA-N.
| Molecular formula | C7H10BNO4 |
|---|---|
| Molecular weight | 182.97 g/mol |
| IUPAC name | 2-ethenyl-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | MGRQGYAVASCCAK-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C=C |
Computed by PubChem (NCBI)