cas: 462068-15-1 — see every product listed under this CAS number, including other names
6-OXO-5,6-DIHYDRO[1,3]DIOXOLO[4,5-G]QUINOLINE-7-CARBALDEHYDE, 95% (CAS 462068-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F852275-100MG |
| cas | 462068-15-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1070.47 Pln | |
| Fluorochem | 1g | 2674.08 Pln | |
| Fluorochem | 5g | 9171.79 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde (CAS 462068-15-1) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde. InChIKey: JHECNOLILDQPIP-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 6-oxo-5H-[1,3]dioxolo[4,5-g]quinoline-7-carbaldehyde |
| InChIKey | JHECNOLILDQPIP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C=C(C(=O)N3)C=O |
Computed by PubChem (NCBI)