CAS 53653-22-8 is the registry number for 2-Hydroxy-6-nitro-1-naphthaldehyde. Offered by: TRC. Available pack sizes: 1g.
2-hydroxy-6-nitronaphthalene-1-carbaldehyde (CAS 53653-22-8) is a chemical compound with the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. IUPAC name: 2-hydroxy-6-nitronaphthalene-1-carbaldehyde. InChIKey: NSMXSOJJDHNPSX-UHFFFAOYSA-N.
| Molecular formula | C11H7NO4 |
|---|---|
| Molecular weight | 217.18 g/mol |
| IUPAC name | 2-hydroxy-6-nitronaphthalene-1-carbaldehyde |
| InChIKey | NSMXSOJJDHNPSX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C=O)O)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)