cas: 22094-62-8 — see every product listed under this CAS number, including other names
6-aminosaccharin, 98%+, 98%+ (CAS 22094-62-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140KE-100mg |
| cas | 22094-62-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 851.60 Pln | |
| Chemat | 5g | 2541.20 Pln |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
6-amino-1,1-dioxo-1,2-benzothiazol-3-one (CAS 22094-62-8) is a chemical compound with the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. IUPAC name: 6-amino-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: SSRKZHLPNHLAKM-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3S |
|---|---|
| Molecular weight | 198.20 g/mol |
| IUPAC name | 6-amino-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | SSRKZHLPNHLAKM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)