cas: 141492-50-4 — see every product listed under this CAS number, including other names
6-isothiocyanato-2,3-dihydro-1,4-benzodioxine, 97%, 97% (CAS 141492-50-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GGL-1g |
| cas | 141492-50-4 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 986.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-isothiocyanato-2,3-dihydro-1,4-benzodioxine (CAS 141492-50-4) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine. InChIKey: KALNNFRLHRAJNK-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine |
| InChIKey | KALNNFRLHRAJNK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)N=C=S |
Computed by PubChem (NCBI)