6-nitrobenzothiazole, 99%, 99%
cas: 2942-06-5 — see every product listed under this CAS number, including other names
6-nitrobenzothiazole, 99%, 99% (CAS 2942-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113YC3-1g |
| cas | 2942-06-5 |
| size | 1g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 250g | 702.80 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 2526.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
6-nitro-1,3-benzothiazole (CAS 2942-06-5) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 6-nitro-1,3-benzothiazole. InChIKey: QLUFBCVWKTWKBF-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 6-nitro-1,3-benzothiazole |
| InChIKey | QLUFBCVWKTWKBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC=N2 |
Computed by PubChem (NCBI)