cas: 944580-91-0 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)imidazo(1,2-a)pyridine, 98% (CAS 944580-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A653299-100mg |
| cas | 944580-91-0 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 766.57 Pln | |
| AmBeed | 10g | 10186.54 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 944580-91-0) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 7-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: TUPNGOKBBWGSGZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 7-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | TUPNGOKBBWGSGZ-UHFFFAOYSA-N |
| SMILES | C1=CN2C=CN=C2C=C1C(F)(F)F |
Computed by PubChem (NCBI)