7-Benzyloxy-1H-indazole-3-carboxylic acid, 97%
cas: 177941-17-2 — see every product listed under this CAS number, including other names
7-Benzyloxy-1H-indazole-3-carboxylic acid, 97% (CAS 177941-17-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A771087-250mg |
| cas | 177941-17-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2389.56 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2397.20 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2569.12 Pln | |
| Fluorochem | 100mg | 961.14 Pln | |
| Fluorochem | 250mg | 1549.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
7-phenylmethoxy-1H-indazole-3-carboxylic acid (CAS 177941-17-2) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 7-phenylmethoxy-1H-indazole-3-carboxylic acid. InChIKey: ZFVAAEXVMARVQU-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 7-phenylmethoxy-1H-indazole-3-carboxylic acid |
| InChIKey | ZFVAAEXVMARVQU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC3=C2NN=C3C(=O)O |
Computed by PubChem (NCBI)