Products 1172902-78-1
CAS 1172902-78-1 is the registry number for 2-(1,6-Naphthyridin-2-yl)benzoic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(1,6-naphthyridin-2-yl)benzoic acid;hydrate (CAS 1172902-78-1) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 2-(1,6-naphthyridin-2-yl)benzoic acid;hydrate. InChIKey: WGOXGTNPJFVPMJ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 2-(1,6-naphthyridin-2-yl)benzoic acid;hydrate |
| InChIKey | WGOXGTNPJFVPMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(C=C2)C=NC=C3)C(=O)O.O |
Computed by PubChem (NCBI)