CAS 301860-84-4 appears in our catalog under these names: 4-(Imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid, 95%, 4-(Imidazo(1,2-a)pyridin-2-ylmethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid (CAS 301860-84-4) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid. InChIKey: KUKPPSPGBJACEI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid |
| InChIKey | KUKPPSPGBJACEI-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)