CAS 1218480-55-7 is the registry number for 2-(7-Oxo-5h-pyrrolo[3,4-b]pyridin-6(7h)-yl)-2-phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)-2-phenylacetic acid (CAS 1218480-55-7) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)-2-phenylacetic acid. InChIKey: GWKNPZHMBBPYBJ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 2-(7-oxo-5H-pyrrolo[3,4-b]pyridin-6-yl)-2-phenylacetic acid |
| InChIKey | GWKNPZHMBBPYBJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1C(C3=CC=CC=C3)C(=O)O)N=CC=C2 |
Computed by PubChem (NCBI)