CAS 1373029-12-9 appears in our catalog under these names: 3-Benzyloxy-6-methyl-pyrrolo[3,4-b]pyridine-5,7-dione, 95%, 3–(Benzyloxy)–6–methyl–5H–pyrrolo(3,4–b)pyridine–5,7(6H)–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 500mg.
6-methyl-3-phenylmethoxypyrrolo[3,4-b]pyridine-5,7-dione (CAS 1373029-12-9) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 6-methyl-3-phenylmethoxypyrrolo[3,4-b]pyridine-5,7-dione. InChIKey: WKVSKFCTAXBLDO-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 6-methyl-3-phenylmethoxypyrrolo[3,4-b]pyridine-5,7-dione |
| InChIKey | WKVSKFCTAXBLDO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C1=O)N=CC(=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)