CAS 924106-25-2 appears in our catalog under these names: 3-Methyl-6-(4-methylphenyl)isoxazolo[5,4-b]pyridine-4-carboxylic acid, 95%, 3-Methyl-6-(4-methylphenyl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 924106-25-2) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: FFNXSDCQMBWROW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-methyl-6-(4-methylphenyl)-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | FFNXSDCQMBWROW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C(=NO3)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)