Products 872108-08-2
CAS 872108-08-2 appears in our catalog under these names: 3-(Imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid, 95%, 3-{imidazo(1,2-a)pyridin-2-ylmethoxy}benzoic acid, 95%, 3-{Imidazo(1,2-a)pyridin-2-ylmethoxy}benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2,5g.
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid (CAS 872108-08-2) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid. InChIKey: ROUKEPGFOKOYLW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)benzoic acid |
| InChIKey | ROUKEPGFOKOYLW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)COC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)