cas: 886756-67-8 — see every product listed under this CAS number, including other names
7-Bromo-1,5-dihydro-4,1-benzoxazepin-2(3H)-one, 95%, 95% (CAS 886756-67-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AEW-100mg |
| cas | 886756-67-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 904.40 Pln | |
| Chemat | 250mg | 1259.60 Pln | |
| Chemat | 1g | 2445.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one (CAS 886756-67-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one. InChIKey: WSNHVMZMIOFLKS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one |
| InChIKey | WSNHVMZMIOFLKS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)NC(=O)CO1 |
Computed by PubChem (NCBI)