cas: 886756-67-8 — see every product listed under this CAS number, including other names
7-Bromo-1,5-dihydro-4,1-benzoxazepin-2(3H)-one, 97% (CAS 886756-67-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1059003-10g |
| cas | 886756-67-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 22015.21 Pln | |
| AmBeed | 5g | 13213.69 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one (CAS 886756-67-8) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one. InChIKey: WSNHVMZMIOFLKS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 7-bromo-1,5-dihydro-4,1-benzoxazepin-2-one |
| InChIKey | WSNHVMZMIOFLKS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)NC(=O)CO1 |
Computed by PubChem (NCBI)