cas: 99067-25-1 — see every product listed under this CAS number, including other names
7-Bromo-2,3-dihydro-1,4-benzodioxin-6-carboxaldehyde (CAS 99067-25-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630752-1G |
| cas | 99067-25-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2408.54 Pln | |
| Fluorochem | 5g | 7089.19 Pln |
| delivery time | 3-4 weeks |
|---|
6-bromo-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde (CAS 99067-25-1) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde. InChIKey: GRPOMPOKJNVQKD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde |
| InChIKey | GRPOMPOKJNVQKD-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C=O |
Computed by PubChem (NCBI)