cas: 1258400-12-2 — see every product listed under this CAS number, including other names
7-Bromo-2,3-dihydrobenzofuran-3-amine Hydrochloride, >97%, >97% (CAS 1258400-12-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HIIF-100mg |
| cas | 1258400-12-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 2358.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1258400-12-2) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IIJLGAROGPJXJC-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | IIJLGAROGPJXJC-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)