CAS 2055848-77-4 appears in our catalog under these names: (3S)-7-Bromo-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, (S)-7-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3S)-7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2055848-77-4) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3S)-7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: IIJLGAROGPJXJC-OGFXRTJISA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3S)-7-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | IIJLGAROGPJXJC-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)