cas: 1438410-03-7 — see every product listed under this CAS number, including other names
7-Bromo-2-Oxo-2H-Chromene-3-Carboxylic Acid, 97% (CAS 1438410-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12FMXF-100mg |
| cas | 1438410-03-7 |
| size | 100mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2651.60 Pln | |
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 1185.02 Pln | |
| Fluorochem | 5g | 4522.38 Pln | |
| Fluorochem | 10g | 5615.75 Pln | |
| Fluorochem | 25g | 11504.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2-oxochromene-3-carboxylic acid (CAS 1438410-03-7) is a chemical compound with the molecular formula C10H5BrO4 and a molecular weight of 269.05 g/mol. IUPAC name: 7-bromo-2-oxochromene-3-carboxylic acid. InChIKey: VVQDKSRVNCYJNC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrO4 |
|---|---|
| Molecular weight | 269.05 g/mol |
| IUPAC name | 7-bromo-2-oxochromene-3-carboxylic acid |
| InChIKey | VVQDKSRVNCYJNC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)