cas: 31169-27-4 — see every product listed under this CAS number, including other names
7-Bromo-4-chlorothieno[3,2-d]pyrimidine 97% (CAS 31169-27-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A501577-250mg |
| cas | 31169-27-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 10g | 420.44 Pln | |
| Ambeed | 25g | 492.75 Pln | |
| Ambeed | 100g | 1343.81 Pln | |
| Ambeed | 500g | 5159.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A501577 |
7-bromo-4-chlorothieno[3,2-d]pyrimidine (CAS 31169-27-4) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 7-bromo-4-chlorothieno[3,2-d]pyrimidine. InChIKey: LJFZDPZIIKOATA-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 7-bromo-4-chlorothieno[3,2-d]pyrimidine |
| InChIKey | LJFZDPZIIKOATA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)