CAS 31169-27-4 appears in our catalog under these names: 7-Bromo-4-chlorothieno[3,2-d]pyrimidine, 95%, 7-Bromo-4-chlorothieno[3,2-d]pyrimidine, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100g, 500g.
7-bromo-4-chlorothieno[3,2-d]pyrimidine (CAS 31169-27-4) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 7-bromo-4-chlorothieno[3,2-d]pyrimidine. InChIKey: LJFZDPZIIKOATA-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 7-bromo-4-chlorothieno[3,2-d]pyrimidine |
| InChIKey | LJFZDPZIIKOATA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)