CAS 1206248-68-1 is the registry number for 2-Bromo-7-chlorothiazolo[5,4-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
2-bromo-7-chloro-[1,3]thiazolo[5,4-c]pyridine (CAS 1206248-68-1) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 2-bromo-7-chloro-[1,3]thiazolo[5,4-c]pyridine. InChIKey: PXIOYTIEFZXIMY-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 2-bromo-7-chloro-[1,3]thiazolo[5,4-c]pyridine |
| InChIKey | PXIOYTIEFZXIMY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C=N1)Cl)N=C(S2)Br |
Computed by PubChem (NCBI)