Products 56844-12-3

CAS 56844-12-3 appears in our catalog under these names: 6-Bromo-4-chlorothieno[2,3-d]pyrimidine 98%, 6-Bromo-4-chlorothieno[2,3-d]pyrimidine, 98%, 98%, 6-Bromo-4-chlorothieno[2,3-d]pyrimidine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

6-bromo-4-chlorothieno[2,3-d]pyrimidine (CAS 56844-12-3) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 6-bromo-4-chlorothieno[2,3-d]pyrimidine. InChIKey: CMIXHHOZGMSYKN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrClN2S
Molecular weight249.52 g/mol
IUPAC name6-bromo-4-chlorothieno[2,3-d]pyrimidine
InChIKeyCMIXHHOZGMSYKN-UHFFFAOYSA-N
SMILESC1=C(SC2=C1C(=NC=N2)Cl)Br

Computed by PubChem (NCBI)