CAS 56844-12-3 appears in our catalog under these names: 6-Bromo-4-chlorothieno[2,3-d]pyrimidine, 98%, 98%, 6-Bromo-4-chlorothieno[2,3-d]pyrimidine, 95%, 6-Bromo-4-chlorothieno[2,3-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
6-bromo-4-chlorothieno[2,3-d]pyrimidine (CAS 56844-12-3) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 6-bromo-4-chlorothieno[2,3-d]pyrimidine. InChIKey: CMIXHHOZGMSYKN-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 6-bromo-4-chlorothieno[2,3-d]pyrimidine |
| InChIKey | CMIXHHOZGMSYKN-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)Br |
Computed by PubChem (NCBI)