CAS 1198759-26-0 appears in our catalog under these names: 2-Bromo-5-chloro-thiazolo[5,4-b]pyridine, 95%, 2-Bromo-5-chlorothiazolo[5,4-b]pyridine, 95%, 95%, 2-Bromo-5-chlorothiazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
2-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine (CAS 1198759-26-0) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 2-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine. InChIKey: HUDIKDNPUIYAKF-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 2-bromo-5-chloro-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | HUDIKDNPUIYAKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(S2)Br)Cl |
Computed by PubChem (NCBI)