CAS 1215206-49-7 appears in our catalog under these names: 4-Bromo-6-chlorobenzo[c][1,2,5]thiadiazole, 98%, 4-Bromo-6-chlorobenzo(c)(1,2,5)thiadiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
4-bromo-6-chloro-2,1,3-benzothiadiazole (CAS 1215206-49-7) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 4-bromo-6-chloro-2,1,3-benzothiadiazole. InChIKey: CKCVNBIVPGTEST-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 4-bromo-6-chloro-2,1,3-benzothiadiazole |
| InChIKey | CKCVNBIVPGTEST-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NSN=C21)Br)Cl |
Computed by PubChem (NCBI)