cas: 108938-16-5 — see every product listed under this CAS number, including other names
7-Bromo-5-methylisatin, ≥95%, ≥95% (CAS 108938-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TT4-100mg |
| cas | 108938-16-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1259.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
7-bromo-5-methyl-1H-indole-2,3-dione (CAS 108938-16-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-5-methyl-1H-indole-2,3-dione. InChIKey: NPDJRIGMWAQKTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-5-methyl-1H-indole-2,3-dione |
| InChIKey | NPDJRIGMWAQKTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)