cas: 1030019-33-0 — see every product listed under this CAS number, including other names
7-CHLORO-PYRAZOLO[1,5-A]PYRIMIDIN-5-CARBOXYLICACID, 95%, 95% (CAS 1030019-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JHF8-250mg |
| cas | 1030019-33-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1936.40 Pln | |
| Chemat | 1g | 4264.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 1030019-33-0) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: BHZYOQSUEKXHBW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | BHZYOQSUEKXHBW-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(C=C(N2N=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)