cas: 1030019-33-0 — see every product listed under this CAS number, including other names
7-Chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid 95% (CAS 1030019-33-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A680662-250mg |
| cas | 1030019-33-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 3941.50 Pln | |
| Ambeed | 1g | 4753.62 Pln | |
| Ambeed | 5g | 14287.75 Pln | |
| Ambeed | 10g | 24978.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A680662 |
7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid (CAS 1030019-33-0) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid. InChIKey: BHZYOQSUEKXHBW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 7-chloropyrazolo[1,5-a]pyrimidine-5-carboxylic acid |
| InChIKey | BHZYOQSUEKXHBW-UHFFFAOYSA-N |
| SMILES | C1=C2N=C(C=C(N2N=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)