cas: 1092349-37-5 — see every product listed under this CAS number, including other names
7-Chloro-6-fluorochroman-4-one, 97% (CAS 1092349-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620785-100MG |
| cas | 1092349-37-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 1388.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-chloro-6-fluoro-2,3-dihydrochromen-4-one (CAS 1092349-37-5) is a chemical compound with the molecular formula C9H6ClFO2 and a molecular weight of 200.59 g/mol. IUPAC name: 7-chloro-6-fluoro-2,3-dihydrochromen-4-one. InChIKey: LWVWBEUHAGWKJR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFO2 |
|---|---|
| Molecular weight | 200.59 g/mol |
| IUPAC name | 7-chloro-6-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | LWVWBEUHAGWKJR-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2C1=O)F)Cl |
Computed by PubChem (NCBI)