cas: 1628517-87-2 — see every product listed under this CAS number, including other names
7-Chloroquinazolin-4(3H)-one hydrochloride, 97% (CAS 1628517-87-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A308297-5g |
| cas | 1628517-87-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 278.32 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-chloro-3H-quinazolin-4-one;hydrochloride (CAS 1628517-87-2) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 7-chloro-3H-quinazolin-4-one;hydrochloride. InChIKey: HRZAROINFGPQSE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 7-chloro-3H-quinazolin-4-one;hydrochloride |
| InChIKey | HRZAROINFGPQSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=CNC2=O.Cl |
Computed by PubChem (NCBI)