cas: 1073262-83-5 — see every product listed under this CAS number, including other names
7-Fluoro-6-methylindoline-2,3-dione, 98% (CAS 1073262-83-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F431289-250MG |
| cas | 1073262-83-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 2569.95 Pln | |
| Fluorochem | 10g | 4475.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-fluoro-6-methyl-1H-indole-2,3-dione (CAS 1073262-83-5) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 7-fluoro-6-methyl-1H-indole-2,3-dione. InChIKey: PUJMIHLZTUIWLX-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 7-fluoro-6-methyl-1H-indole-2,3-dione |
| InChIKey | PUJMIHLZTUIWLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C(=O)N2)F |
Computed by PubChem (NCBI)