7-Hydroxy-2H-chromen-2-one, 97%, 97%
cas: 93-35-6 — see every product listed under this CAS number, including other names
7-Hydroxy-2H-chromen-2-one, 97%, 97% (CAS 93-35-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114V0R-50g |
| cas | 93-35-6 |
| size | 50g |
| availability | 25000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 198.80 Pln | |
| Chemat | 250g | 698.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 2570.00 Pln | |
| Chemat | 5kg | 6369.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Umbelliferone is a hydroxycoumarin that is coumarin substituted by a hydroxy group ay position 7. It has a role as a fluorescent probe, a plant metabolite and a food component.
Source: ChEBI
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 7-hydroxychromen-2-one |
| InChIKey | ORHBXUUXSCNDEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=O)O2)O |
Computed by PubChem (NCBI)