cas: 1343932-64-8 — see every product listed under this CAS number, including other names
7-Isoquinolinecarboxylic acid, 1,2,3,4-tetrahydro-1-oxo- 95% (CAS 1343932-64-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222063-100mg |
| cas | 1343932-64-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1532.94 Pln | |
| Ambeed | 5g | 6005.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A222063 |
1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid (CAS 1343932-64-8) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid. InChIKey: HAXKBOAGHSGHLU-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-oxo-3,4-dihydro-2H-isoquinoline-7-carboxylic acid |
| InChIKey | HAXKBOAGHSGHLU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)