cas: 128717-77-1 — see every product listed under this CAS number, including other names
7-Methoxy-1H-indole-3-carboxylic acid, 98% (CAS 128717-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040444-250MG |
| cas | 128717-77-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 500mg | 289.50 Pln | |
| Fluorochem | 1g | 409.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-methoxy-1H-indole-3-carboxylic acid (CAS 128717-77-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 7-methoxy-1H-indole-3-carboxylic acid. InChIKey: MSALXMDIYCKASR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 7-methoxy-1H-indole-3-carboxylic acid |
| InChIKey | MSALXMDIYCKASR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC=C2C(=O)O |
Computed by PubChem (NCBI)