cas: 80353-94-2 — see every product listed under this CAS number, including other names
7-Methyl-imidazo[1,2-a]pyridine-2-carboxylic acid, 95% (CAS 80353-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F057885-100MG |
| cas | 80353-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 5g | 1757.73 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
7-methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 80353-94-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: GWOWWQVYWZHBRI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | GWOWWQVYWZHBRI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C(=O)O |
Computed by PubChem (NCBI)