cas: 30450-62-5 — see every product listed under this CAS number, including other names
7-Nitro-1,2,3,4-tetrahydroquinoline, >98.0%(GC)(T) (CAS 30450-62-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0955-5G |
| cas | 30450-62-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 167.52 Pln | |
| TCI | 25g | 521.56 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
7-nitro-1,2,3,4-tetrahydroquinoline (CAS 30450-62-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-nitro-1,2,3,4-tetrahydroquinoline. InChIKey: WSWMGHRLUYADNA-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-nitro-1,2,3,4-tetrahydroquinoline |
| InChIKey | WSWMGHRLUYADNA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)[N+](=O)[O-])NC1 |
Computed by PubChem (NCBI)