cas: 108938-16-5 — see every product listed under this CAS number, including other names
7-bromo-5-methyl-1H-indole-2,3-dione (CAS 108938-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F308953-100MG |
| cas | 108938-16-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 752.88 Pln | |
| Fluorochem | 5g | 2059.71 Pln |
| delivery time | 3-4 weeks |
|---|
7-bromo-5-methyl-1H-indole-2,3-dione (CAS 108938-16-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-5-methyl-1H-indole-2,3-dione. InChIKey: NPDJRIGMWAQKTQ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-5-methyl-1H-indole-2,3-dione |
| InChIKey | NPDJRIGMWAQKTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)Br)NC(=O)C2=O |
Computed by PubChem (NCBI)