cas: 869478-09-1 — see every product listed under this CAS number, including other names
8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%, 97% (CAS 869478-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IE0S-100mg |
| cas | 869478-09-1 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 869478-09-1) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: URTYAHMRXXVHKS-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | URTYAHMRXXVHKS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC(=C1)OCC3=CC=CC=C3)NC(=O)CO2 |
Computed by PubChem (NCBI)