cas: 869478-09-1 — see every product listed under this CAS number, including other names
8-Acetyl-6-(benzyloxy)-2H-benzo[b][1,4]oxazin-3(4H)-one (CAS 869478-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323233-100MG |
| cas | 869478-09-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 5g | 2215.90 Pln |
| delivery time | 3-4 weeks |
|---|
8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one (CAS 869478-09-1) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 297.30 g/mol. IUPAC name: 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one. InChIKey: URTYAHMRXXVHKS-UHFFFAOYSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 8-acetyl-6-phenylmethoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | URTYAHMRXXVHKS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C(=CC(=C1)OCC3=CC=CC=C3)NC(=O)CO2 |
Computed by PubChem (NCBI)